candims candims

07-11-2022
Physics

contestada

Which removes carbon dioxide from the atmosphere, acting as a carbon
sink?
OA. Formation of carbonates in the ocean
OB. Burning plants
OC. Burning fossil fuels
OD. Plant respiration
Answer is A

Respuesta :

Otras preguntas

what is the inverse of the function f(x)=2x-10

what is the answer for this question?

Which component is released from the active site of an enzyme during a chemical reaction?

Fiona bought some socks that cost $4.95 for each pair and some belts that cost $6.55 each. Fiona spent $27.95 in all. Let a represent the number of pairs of soc

Use an appropriate identity to find the exact value of the expression. cos(310)cos(50)-sin(310)sin(50)

The equation 9+12m=6+15(m-1) models the following situation: Movie-rental company A charges a sign-up fee of $9 plus $12 per month, and company B charges $6 for

When you ask the question, “Has this author been cited in other resources?” which aspect of the Web resource are you evaluating? Reliability Currency Relevance

How do both emerson's "self-reliance" and thoreau's walden portray society's effect on the individual?

Craig is two years old, and he likes to put on his own coat and shoes. however, his mother often becomes impatient waiting for him to get ready, and she usually

If a line with a slope of 4 crosses the y-axis at (0, 1), what is the equation of the line? y − 4x = 1 y + 4x = 1 x − 4y = 1 x + 4y = 1