ironclone13 ironclone13

07-11-2018
Mathematics

contestada

Jackie filled the blue water balloon with 12.25 ounces of water and the red water balloon with 5.5 ounces of water. How much more water was in the blue balloon than the red one? oz

Respuesta :

jordancibinski jordancibinski

07-11-2018

All you do is subtract 5.5 oz from 12.25 oz, so the answer is that the blue balloon has 6.75 more oz than the other balloon.

Answer Link

Otras preguntas

Identify what universal themes does homer explore in the odyssey

The great unc basketball coach, dean smith, was able to win so often because his team understood what the opponent was trying to do on offense and defense. dean

Linolenic acid has cis double bonds with the formula ch3ch2ch=chch2ch=chch2ch=ch(ch2)7cooh. write out the abbreviated systematic numbering for this fatty acid.

Nitric acid (HNO3) is a strong acid, and it is titrated with a standard solution of sodium hydroxide (NaOH), a strong base. Which describes the pH of the equiva

what are some ways that healthcaer professionals can decrease the risk of drug abuse and addiction?

Rolando had $120000 in a CD at Big Bucks Bank, which just failed. If the FDIC insurance limit per depositor, per bank, is $250000, how much will Rolando get bac

What factor influenced the peace treaties that ended World War I ,and how did people react to the treaties

Why is gunshot residue important for a forensic scientist? What are the potential complications with this type of evidence?

Conflict can be reduced in all of the following ways except __________. Please select the best answer from the choices provided establishing superordinate goa

Why were the Sandinistas important to Nicaragua?