malinda827 malinda827

09-08-2021
Mathematics

contestada

4) In the proof below, what is the missing reason?

4 In the proof below what is the missing reason class=

Respuesta :

sqdancefan sqdancefan

09-08-2021

9514 1404 393

Answer:

(c) CPCTC

Step-by-step explanation:

Even if you don't know the meaning of CPCTC, you can eliminate the other choices because they refer to the whole triangle, not two corresponding angles.

Angles B and D are corresponding angles in the congruent triangles. The reason they are congruent is ...

Corresponding Parts of Congruent Triangles are Congruent (CPCTC)

Answer Link

Otras preguntas

which of he following sets limits on the power of government A. the congress B. the declaration of independence C. the constitution D. the justice department

PLZ someone help me

20 points!!!will give brainliest!!!What is the mean absolute deviation of the data set? 12, 15, 7, 4, 9, 10, 9, 6

The sector of a circle with a 12 inches radius has a central angle measure of 60°. What is the exact area of the sector in terms of π ?

What is the message of the short story el ahogado mas hertmoso del mundo?

Use an appropriate identity to find the exact value of the expression. cos(310)cos(50)-sin(310)sin(50)

what is a substrate?

What is the equation of the line that passes through the point (3,0) and is perpendicular to the line 2x-y=5?

Which structure does Shakespeare use in writing his plays?

A muskrat population is growing exponentially. What might cause this population to enter logistic growth? A. resources become scarce B. birth rate increases C.