hayleymaier10 hayleymaier10
  • 06-01-2024
  • Chemistry
contestada

3 C2H3O2H+Al(OH)3-Al(C2H3O2)3+H2O
Determine the mass of aluminum acetated that can be made if this reaction with 125 grams of acetic acid and 275 gram of aluminum hydroxide

Respuesta :

Otras preguntas

Using a physical or diagram model of the Sun, the Moon, and the Earth to explain the reason for seasons
Three consecutive integers have a sum of 78. Find the integers
A lake such as the one pictured is considered an open system because A. it is isolated by the mountains surrounding it. B. there is an input and output of energ
What do you think makes a particular action a crime? Most people haven’t read all of the state and federal laws defining illegal acts. So as a member of society
What is moral behaviour?Write yourself..Dont copy..​
I _____ no difficulty in learning English since I__________to learn it six years ago. a. have had / began b. had had / begin c. had / has begun d. am having /
What was Marx reacting to when he was creating his idea for the communist society?
Write 100-word email to your close friend telling her about shopping preferences
In a client's training cycle, one day or training session is known as which of the following?
f(x) = x² + 10 What is the average rate of change of f over the interval [ -2,-1?​