brownboynati brownboynati

06-05-2021
Mathematics

contestada

the mean of 3,7,8,10 and x is 6 find x

Respuesta :

altavistard altavistard

06-05-2021

Answer:

x = 2

Step-by-step explanation:

The mean is

3 + 7 + 8 + 10 + x

------------------------- = 6

5

Multiplying both sides by 5, we get:

3 + 7 + 8 + 10 + x = 30

Then 28 + x = 30, so that x must be 2

x = 2

Answer Link

Otras preguntas

Find the exact value of csc(-1860). Not exactly for sure where to start, i've gotten to this, csc(300)=csc(360-60)=csc(-60) but I am not for sure where to go a

Please need help thank you

Which element of modernist poetry is evident in this excerpt from "The Negro Speaks of Rivers" by Langston Hughes? I've known rivers: I've known rivers ancien

CO2(G)<-->CO2(aq) is an example of: a.) sublimation b.) homeogeneous equilibriuum c.) heterogeneous equilbrium d.) chemical equilibrium

In a high school, 7% of the students play the piano. This is 21 students. Choose the expressions that complete each step involved in setting up and solving t

Athens placed the greatest emphasis on

Write an equation of the line that passes through the point (2, -1) and is perpendicular to the line y = -2x + 1, then use Point- Slope form to write the equati

Sixteen-year-old rashad is on his high school diving team. while they are practicing, a group of girls from the girls' swim team stop by. rashad immediately tri

alonzo rented a truck for one day. there was a base fee of $14.95, and there was an additional charge of 89 cents for each mile driven. alonzo had to pay $156.4

Medical specialty that involves the diagnosis and treatment of persons who suffer sudden illness or trauma and require immediate medical care is called